CAS 1800534-49-9 is the registry number for 4,4'–Bis(bromoethynyl)–1,1'–biphenyl. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
1-(2-bromoethynyl)-4-[4-(2-bromoethynyl)phenyl]benzene (CAS 1800534-49-9) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1-(2-bromoethynyl)-4-[4-(2-bromoethynyl)phenyl]benzene. InChIKey: CDDHUFDZDMMOKK-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1-(2-bromoethynyl)-4-[4-(2-bromoethynyl)phenyl]benzene |
| InChIKey | CDDHUFDZDMMOKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CBr)C2=CC=C(C=C2)C#CBr |
Computed by PubChem (NCBI)