cas: 129812-23-3 — see every product listed under this CAS number, including other names
1,2-Dimethyl-naphtho[2,1-b]furan, 95%, 95% (CAS 129812-23-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111TQ3-100mg |
| cas | 129812-23-3 |
| size | 100mg |
| availability | 0.85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1038.80 Pln | |
| Chemat | 250mg | 1686.80 Pln | |
| Chemat | 500mg | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,2-dimethylbenzo[e][1]benzofuran (CAS 129812-23-3) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 1,2-dimethylbenzo[e][1]benzofuran. InChIKey: YHYOQUQINUTULF-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1,2-dimethylbenzo[e][1]benzofuran |
| InChIKey | YHYOQUQINUTULF-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C3=CC=CC=C3C=C2)C |
Computed by PubChem (NCBI)