CAS 4973-29-9 appears in our catalog under these names: 4-Phenoxystyrene, 95%, 1–Phenoxy–4–vinylbenzene, 4-Phenoxystyrene, stabilised with 0.1% p-tert-butylcatechol, 1-Phenoxy-4-vinylbenzene, 95%, 95%, 1-Phenoxy-4-vinylbenzene, 98% (stabilized with TBC). Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g, 50g, 100g, 250mg.
1-ethenyl-4-phenoxybenzene (CAS 4973-29-9) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 1-ethenyl-4-phenoxybenzene. InChIKey: UULPGUKSBAXNJN-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1-ethenyl-4-phenoxybenzene |
| InChIKey | UULPGUKSBAXNJN-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)