CAS 76425-88-2 appears in our catalog under these names: 3-[(E)-2-Phenylvinyl]phenol, 95%, trans-3-Hydroxystilbene, >95% (HPLC), trans-3-Hydroxystilbene, 3-Styrylphenol, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 50mg, 2g.
3-[(E)-2-phenylethenyl]phenol (CAS 76425-88-2) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 3-[(E)-2-phenylethenyl]phenol. InChIKey: XBHJTSIYYWRJFQ-MDZDMXLPSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 3-[(E)-2-phenylethenyl]phenol |
| InChIKey | XBHJTSIYYWRJFQ-MDZDMXLPSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)