CAS 129812-23-3 appears in our catalog under these names: 1,2-Dimethyl-naphtho[2,1-b]furan, 95%, 1,2–Dimethyl–naphtho(2,1–b)furan, 1,2-Dimethyl-naphtho[2,1-b]furan, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 25mg, 500mg.
1,2-dimethylbenzo[e][1]benzofuran (CAS 129812-23-3) is a chemical compound with the molecular formula C14H12O and a molecular weight of 196.24 g/mol. IUPAC name: 1,2-dimethylbenzo[e][1]benzofuran. InChIKey: YHYOQUQINUTULF-UHFFFAOYSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 196.24 g/mol |
| IUPAC name | 1,2-dimethylbenzo[e][1]benzofuran |
| InChIKey | YHYOQUQINUTULF-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C3=CC=CC=C3C=C2)C |
Computed by PubChem (NCBI)