cas: 486422-31-5 — see every product listed under this CAS number, including other names
1-((4-Bromophenyl)sulfonyl)-4-methyl-1,4-diazepane, 97% (CAS 486422-31-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A184556-25g |
| cas | 486422-31-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 7178.92 Pln | |
| AmBeed | 250mg | 558.25 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(4-bromophenyl)sulfonyl-4-methyl-1,4-diazepane (CAS 486422-31-5) is a chemical compound with the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonyl-4-methyl-1,4-diazepane. InChIKey: QCAXTVFTVHQJJQ-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O2S |
|---|---|
| Molecular weight | 333.25 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonyl-4-methyl-1,4-diazepane |
| InChIKey | QCAXTVFTVHQJJQ-UHFFFAOYSA-N |
| SMILES | CN1CCCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)