CAS 1160924-46-8 is the registry number for 1-{[(3-Bromophenyl)methane]sulfonyl}-4-methylpiperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-[(3-bromophenyl)methylsulfonyl]-4-methylpiperazine (CAS 1160924-46-8) is a chemical compound with the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. IUPAC name: 1-[(3-bromophenyl)methylsulfonyl]-4-methylpiperazine. InChIKey: FWENBHYZPMKMGM-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O2S |
|---|---|
| Molecular weight | 333.25 g/mol |
| IUPAC name | 1-[(3-bromophenyl)methylsulfonyl]-4-methylpiperazine |
| InChIKey | FWENBHYZPMKMGM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)CC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)