Products 1622834-39-2
CAS 1622834-39-2 is the registry number for tert-Butyl 3-(5-bromothiazol-2-yl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate (CAS 1622834-39-2) is a chemical compound with the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. IUPAC name: tert-butyl 3-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate. InChIKey: UACBNHAVXPSPGP-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O2S |
|---|---|
| Molecular weight | 333.25 g/mol |
| IUPAC name | tert-butyl 3-(5-bromo-1,3-thiazol-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | UACBNHAVXPSPGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C2=NC=C(S2)Br |
Computed by PubChem (NCBI)