CAS 486422-31-5 appears in our catalog under these names: 1-[(4-Bromobenzene)sulfonyl]-4-methylhomopiperazine, 95%, 1-((4-Bromophenyl)sulfonyl)-4-methyl-1,4-diazepane, 97%, 1–((4–Bromophenyl)sulfonyl)–4–methyl–1,4–diazepane. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g, 250mg, 100mg.
1-(4-bromophenyl)sulfonyl-4-methyl-1,4-diazepane (CAS 486422-31-5) is a chemical compound with the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonyl-4-methyl-1,4-diazepane. InChIKey: QCAXTVFTVHQJJQ-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O2S |
|---|---|
| Molecular weight | 333.25 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonyl-4-methyl-1,4-diazepane |
| InChIKey | QCAXTVFTVHQJJQ-UHFFFAOYSA-N |
| SMILES | CN1CCCN(CC1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)