cas: 530081-57-3 — see every product listed under this CAS number, including other names
1-((4-Bromophenyl)sulfonyl)azetidine (CAS 530081-57-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212662-1G |
| cas | 530081-57-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 10g | 3189.52 Pln |
| delivery time | 3-4 weeks |
|---|
1-(4-bromophenyl)sulfonylazetidine (CAS 530081-57-3) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 1-(4-bromophenyl)sulfonylazetidine. InChIKey: MDIDQNAFUFFXTB-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 1-(4-bromophenyl)sulfonylazetidine |
| InChIKey | MDIDQNAFUFFXTB-UHFFFAOYSA-N |
| SMILES | C1CN(C1)S(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)