Products 1379332-18-9

CAS 1379332-18-9 is the registry number for 6-Bromo-3,3-dimethyl-2,3-dihydrobenzo[d]isothiazole 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

6-bromo-3,3-dimethyl-2H-1,2-benzothiazole 1,1-dioxide (CAS 1379332-18-9) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-2H-1,2-benzothiazole 1,1-dioxide. InChIKey: DJFQXGRKCZNMRW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrNO2S
Molecular weight276.15 g/mol
IUPAC name6-bromo-3,3-dimethyl-2H-1,2-benzothiazole 1,1-dioxide
InChIKeyDJFQXGRKCZNMRW-UHFFFAOYSA-N
SMILESCC1(C2=C(C=C(C=C2)Br)S(=O)(=O)N1)C

Computed by PubChem (NCBI)