CAS 1379332-18-9 is the registry number for 6-Bromo-3,3-dimethyl-2,3-dihydrobenzo[d]isothiazole 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-3,3-dimethyl-2H-1,2-benzothiazole 1,1-dioxide (CAS 1379332-18-9) is a chemical compound with the molecular formula C9H10BrNO2S and a molecular weight of 276.15 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-2H-1,2-benzothiazole 1,1-dioxide. InChIKey: DJFQXGRKCZNMRW-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2S |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-2H-1,2-benzothiazole 1,1-dioxide |
| InChIKey | DJFQXGRKCZNMRW-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Br)S(=O)(=O)N1)C |
Computed by PubChem (NCBI)