cas: 324059-00-9 — see every product listed under this CAS number, including other names
1-((4-bromo-2-methylbenzene)sulfonyl)piperidine, 98% (CAS 324059-00-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A730524-25g |
| cas | 324059-00-9 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 5486.32 Pln | |
| AmBeed | 250mg | 317.38 Pln | |
| AmBeed | 1g | 369.46 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(4-bromo-2-methylphenyl)sulfonylpiperidine (CAS 324059-00-9) is a chemical compound with the molecular formula C12H16BrNO2S and a molecular weight of 318.23 g/mol. IUPAC name: 1-(4-bromo-2-methylphenyl)sulfonylpiperidine. InChIKey: MLZHDVKZGBUFLU-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2S |
|---|---|
| Molecular weight | 318.23 g/mol |
| IUPAC name | 1-(4-bromo-2-methylphenyl)sulfonylpiperidine |
| InChIKey | MLZHDVKZGBUFLU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)S(=O)(=O)N2CCCCC2 |
Computed by PubChem (NCBI)