Products 2204559-72-6

CAS 2204559-72-6 is the registry number for 5-Bromo-2-ethylsulfanyl-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 5-bromo-2-ethylsulfanylpyridine-3-carboxylate (CAS 2204559-72-6) is a chemical compound with the molecular formula C12H16BrNO2S and a molecular weight of 318.23 g/mol. IUPAC name: tert-butyl 5-bromo-2-ethylsulfanylpyridine-3-carboxylate. InChIKey: SLWLNECIFJDBCR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16BrNO2S
Molecular weight318.23 g/mol
IUPAC nametert-butyl 5-bromo-2-ethylsulfanylpyridine-3-carboxylate
InChIKeySLWLNECIFJDBCR-UHFFFAOYSA-N
SMILESCCSC1=C(C=C(C=N1)Br)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)