Products 850429-73-1
CAS 850429-73-1 appears in our catalog under these names: 1-(3-Bromo-4-methylphenylsulfonyl)piperidine, 98%, 1-((3-Bromo-4-methylphenyl)sulfonyl)piperidine 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
1-(3-bromo-4-methylphenyl)sulfonylpiperidine (CAS 850429-73-1) is a chemical compound with the molecular formula C12H16BrNO2S and a molecular weight of 318.23 g/mol. IUPAC name: 1-(3-bromo-4-methylphenyl)sulfonylpiperidine. InChIKey: OAJCSDNGGCUYRJ-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2S |
|---|---|
| Molecular weight | 318.23 g/mol |
| IUPAC name | 1-(3-bromo-4-methylphenyl)sulfonylpiperidine |
| InChIKey | OAJCSDNGGCUYRJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N2CCCCC2)Br |
Computed by PubChem (NCBI)