Products 1022438-79-4
CAS 1022438-79-4 is the registry number for 1-[(3-Bromobenzene)sulfonyl]homopiperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(3-bromophenyl)sulfonylazepane (CAS 1022438-79-4) is a chemical compound with the molecular formula C12H16BrNO2S and a molecular weight of 318.23 g/mol. IUPAC name: 1-(3-bromophenyl)sulfonylazepane. InChIKey: XDMGKPLXTVIENO-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2S |
|---|---|
| Molecular weight | 318.23 g/mol |
| IUPAC name | 1-(3-bromophenyl)sulfonylazepane |
| InChIKey | XDMGKPLXTVIENO-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)S(=O)(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)