cas: 871666-58-9 — see every product listed under this CAS number, including other names
1-((4-tert-Butylphenyl)methyl)-5,6-dimethyl-1H-1,3-benzodiazole, 95% (CAS 871666-58-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1108053-10g |
| cas | 871666-58-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 11495.05 Pln | |
| AmBeed | 5g | 7686.70 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[(4-tert-butylphenyl)methyl]-5,6-dimethylbenzimidazole (CAS 871666-58-9) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: 1-[(4-tert-butylphenyl)methyl]-5,6-dimethylbenzimidazole. InChIKey: BQYNIPRKHAMXMM-UHFFFAOYSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 1-[(4-tert-butylphenyl)methyl]-5,6-dimethylbenzimidazole |
| InChIKey | BQYNIPRKHAMXMM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)CC3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)