CAS 32531-19-4 is the registry number for Maropitant Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine (CAS 32531-19-4) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: (2R,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine. InChIKey: MECDCHFRZHLREI-WOJBJXKFSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | (2R,3R)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine |
| InChIKey | MECDCHFRZHLREI-WOJBJXKFSA-N |
| SMILES | C1CN2CCC1[C@H]([C@H]2C(C3=CC=CC=C3)C4=CC=CC=C4)N |
Computed by PubChem (NCBI)