CAS 871666-58-9 appears in our catalog under these names: 1-(4-tert-Butylbenzyl)-5,6-dimethyl-1h-benzimidazole, 95%, 1-((4-tert-Butylphenyl)methyl)-5,6-dimethyl-1H-1,3-benzodiazole, 95%, 1-(4-tert-Butylbenzyl)-5,6-dimethyl-1H-benzimidazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1-[(4-tert-butylphenyl)methyl]-5,6-dimethylbenzimidazole (CAS 871666-58-9) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: 1-[(4-tert-butylphenyl)methyl]-5,6-dimethylbenzimidazole. InChIKey: BQYNIPRKHAMXMM-UHFFFAOYSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 1-[(4-tert-butylphenyl)methyl]-5,6-dimethylbenzimidazole |
| InChIKey | BQYNIPRKHAMXMM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)CC3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)