CAS 142035-23-2 appears in our catalog under these names: (2S,3S)-2-Benzhydrylquinuclidin-3-amine, Maropitant Impurity 3. Offered by: TRC, Chemat Brand. Available pack sizes: 100mg, on request.
(2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine (CAS 142035-23-2) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: (2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine. InChIKey: MECDCHFRZHLREI-PMACEKPBSA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | (2S,3S)-2-benzhydryl-1-azabicyclo[2.2.2]octan-3-amine |
| InChIKey | MECDCHFRZHLREI-PMACEKPBSA-N |
| SMILES | C1CN2CCC1[C@@H]([C@@H]2C(C3=CC=CC=C3)C4=CC=CC=C4)N |
Computed by PubChem (NCBI)