cas: 635-84-7 — see every product listed under this CAS number, including other names
1-(1,1'-Biphenyl-4-yl)-2-chloroethanone, 95% (CAS 635-84-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F067870-5G |
| cas | 635-84-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 25g | 534.20 Pln | |
| Fluorochem | 100g | 1913.93 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-1-(4-phenylphenyl)ethanone (CAS 635-84-7) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-chloro-1-(4-phenylphenyl)ethanone. InChIKey: IQEIGQFNDLINOT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-chloro-1-(4-phenylphenyl)ethanone |
| InChIKey | IQEIGQFNDLINOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)CCl |
Computed by PubChem (NCBI)