CAS 5002-13-1 is the registry number for 4-Acetyl-3'-chlorobiphenyl, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-[4-(3-chlorophenyl)phenyl]ethanone (CAS 5002-13-1) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 1-[4-(3-chlorophenyl)phenyl]ethanone. InChIKey: DUFBYEORCCIAEY-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 1-[4-(3-chlorophenyl)phenyl]ethanone |
| InChIKey | DUFBYEORCCIAEY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)