CAS 635-84-7 appears in our catalog under these names: 2-Chloro-4'-phenylacetophenone, 95%, 2–Chloro–4'–Phenylacetophenone, 2-Chloro-4'-phenylacetophenone, >99.0%(GC)(T), 1-([1,1-Biphenyl]-4-yl)-2-chloroethanone, 98%, 98%, 1-(1,1'-Biphenyl-4-yl)-2-chloroethanone, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g.
2-chloro-1-(4-phenylphenyl)ethanone (CAS 635-84-7) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-chloro-1-(4-phenylphenyl)ethanone. InChIKey: IQEIGQFNDLINOT-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-chloro-1-(4-phenylphenyl)ethanone |
| InChIKey | IQEIGQFNDLINOT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)CCl |
Computed by PubChem (NCBI)