CAS 39889-69-5 appears in our catalog under these names: Biphenyl-4-ylacetyl chloride, 96%, 2-((1,1'-Biphenyl)-4-yl)acetyl chloride, 97%, 2-([1,1'-Biphenyl]-4-yl)acetyl chloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 25g, 1g, 10g, 5g, 100mg.
2-(4-phenylphenyl)acetyl chloride (CAS 39889-69-5) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-(4-phenylphenyl)acetyl chloride. InChIKey: HWTMLSYLXGLSDF-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-(4-phenylphenyl)acetyl chloride |
| InChIKey | HWTMLSYLXGLSDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)Cl |
Computed by PubChem (NCBI)