cas: 53330-94-2 — see every product listed under this CAS number, including other names
1-(1H-Indol-5-yl)-ethanone, 97% (CAS 53330-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040212-100MG |
| cas | 53330-94-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 1658.81 Pln | |
| Fluorochem | 25g | 4657.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(1H-indol-5-yl)ethanone (CAS 53330-94-2) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 1-(1H-indol-5-yl)ethanone. InChIKey: GOFIUEUUROFVMA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 1-(1H-indol-5-yl)ethanone |
| InChIKey | GOFIUEUUROFVMA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)NC=C2 |
Computed by PubChem (NCBI)