CAS 53330-94-2 appears in our catalog under these names: 5-Acetylindole, min. 90 %, 2 g, 5-Acetylindole, 97%, 5-Acetylindole, 1-(1H-Indol-5-yl)ethanone 97%, 1-(1H-Indol-5-yl)ethanone, 97%, 97%. Offered by: Roth, Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 2g, 1g, 250mg, 10g, 5g, 25g, 100mg, 500mg.
1-(1H-indol-5-yl)ethanone (CAS 53330-94-2) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 1-(1H-indol-5-yl)ethanone. InChIKey: GOFIUEUUROFVMA-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 1-(1H-indol-5-yl)ethanone |
| InChIKey | GOFIUEUUROFVMA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)NC=C2 |
Computed by PubChem (NCBI)