cas: 137958-96-4 — see every product listed under this CAS number, including other names
1-(2,4-Dichlorophenyl)-2-hydroxyethan-1-one (CAS 137958-96-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F727876-100MG |
| cas | 137958-96-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2939.61 Pln | |
| Fluorochem | 250mg | 3444.64 Pln | |
| Fluorochem | 1g | 4126.69 Pln | |
| Fluorochem | 5g | 14347.05 Pln |
| delivery time | 3-4 weeks |
|---|
1-(2,4-dichlorophenyl)-2-hydroxyethanone (CAS 137958-96-4) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2-hydroxyethanone. InChIKey: QDLQMALYLVMPTR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2-hydroxyethanone |
| InChIKey | QDLQMALYLVMPTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)CO |
Computed by PubChem (NCBI)