CAS 5607-64-7 appears in our catalog under these names: 4-Chloro-2-methoxybenzoyl chloride, 95%, Benzoyl chloride, 4-chloro-2-methoxy-, 95%+, 95%+. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-chloro-2-methoxybenzoyl chloride (CAS 5607-64-7) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 4-chloro-2-methoxybenzoyl chloride. InChIKey: OKEFBVALFLRAFV-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 4-chloro-2-methoxybenzoyl chloride |
| InChIKey | OKEFBVALFLRAFV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)