CAS 23468-31-7 is the registry number for 6-Chloropiperonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
5-chloro-6-(chloromethyl)-1,3-benzodioxole (CAS 23468-31-7) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 5-chloro-6-(chloromethyl)-1,3-benzodioxole. InChIKey: APJKOQPCHGXQBI-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 5-chloro-6-(chloromethyl)-1,3-benzodioxole |
| InChIKey | APJKOQPCHGXQBI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CCl)Cl |
Computed by PubChem (NCBI)