CAS 10236-60-9 appears in our catalog under these names: 2,3-Dichlorophenylacetic acid, 98%, 2,3–Dichlorophenylacetic Acid, 2,3-Dichlorophenylacetic acid, 98% , 2,3-Dichlorophenylacetic Acid, >98.0%(GC)(T), 2,3-Dichlorophenylacetic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 500g, 5g, 1g, 100g, 10g.
2-(2,3-dichlorophenyl)acetic acid (CAS 10236-60-9) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)acetic acid. InChIKey: YWMXEUIQZOQESD-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)acetic acid |
| InChIKey | YWMXEUIQZOQESD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)