cas: 6326-14-3 — see every product listed under this CAS number, including other names
1-(2,4-Dichlorophenyl)-2-thiourea (CAS 6326-14-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010664-1G |
| cas | 6326-14-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 221.81 Pln | |
| Fluorochem | 25g | 575.86 Pln | |
| Fluorochem | 100g | 1627.57 Pln |
| delivery time | 2-3 weeks |
|---|
(2,4-dichlorophenyl)thiourea (CAS 6326-14-3) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: (2,4-dichlorophenyl)thiourea. InChIKey: HSWCDFOASWNGOM-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | (2,4-dichlorophenyl)thiourea |
| InChIKey | HSWCDFOASWNGOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC(=S)N |
Computed by PubChem (NCBI)