CAS 1434142-20-7 is the registry number for 2,4-Dichloro-6,8-dihydro-5h-thiopyrano[3,4-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,4-dichloro-6,8-dihydro-5H-thiopyrano[3,4-d]pyrimidine (CAS 1434142-20-7) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: 2,4-dichloro-6,8-dihydro-5H-thiopyrano[3,4-d]pyrimidine. InChIKey: KCSFUSMUQZWHHS-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | 2,4-dichloro-6,8-dihydro-5H-thiopyrano[3,4-d]pyrimidine |
| InChIKey | KCSFUSMUQZWHHS-UHFFFAOYSA-N |
| SMILES | C1CSCC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)