CAS 41542-06-7 appears in our catalog under these names: 1-(2,3-Dichlorophenyl)-2-thiourea, 95%, 1-(2,3-Dichlorophenyl)-2-thiourea. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
(2,3-dichlorophenyl)thiourea (CAS 41542-06-7) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: (2,3-dichlorophenyl)thiourea. InChIKey: AHQMVDBEJWQFIR-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | (2,3-dichlorophenyl)thiourea |
| InChIKey | AHQMVDBEJWQFIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)NC(=S)N |
Computed by PubChem (NCBI)