CAS 87466-23-7 appears in our catalog under these names: 2,4-Dichloro-7,8-dihydro-6h-thiopyrano[3,2-d]pyrimidine, 95%, 2,4-Dichloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine, 95+%, 95+%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 1g, 5g, 25g.
2,4-dichloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine (CAS 87466-23-7) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: 2,4-dichloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine. InChIKey: HIKOVOQFJFSCLL-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | 2,4-dichloro-7,8-dihydro-6H-thiopyrano[3,2-d]pyrimidine |
| InChIKey | HIKOVOQFJFSCLL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=NC(=N2)Cl)Cl)SC1 |
Computed by PubChem (NCBI)