cas: 1215415-04-5 — see every product listed under this CAS number, including other names
1-(2,4-Dichlorophenyl)cyclopropanamine hydrochloride 96% (CAS 1215415-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A656220-100mg |
| cas | 1215415-04-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 637.38 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A656220 |
1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1215415-04-5) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: DENBZVWTMBOJOP-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | DENBZVWTMBOJOP-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)