cas: 1215415-04-5 — see every product listed under this CAS number, including other names
1-(2,4-DICHLOROPHENYL)CYCLOPROPANAMINE HCL, 97% (CAS 1215415-04-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386453-100MG |
| cas | 1215415-04-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 2903.16 Pln | |
| Fluorochem | 10g | 5735.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1215415-04-5) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: DENBZVWTMBOJOP-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | DENBZVWTMBOJOP-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)