CAS 578-16-5 appears in our catalog under these names: 2',4'-Dimethoxy-2,2,2-trifluoroacetophenone, 95%, 2,2,2-TRIFLUORO-2',4'-DIMETHOXYACETO-, 2,2,2-Trifluoro-2′,4′-dimethoxyacetophenone, 97%, 97%, 2',4'-Dimethoxy-2,2,2-trifluoroacetophenone, 97%. Offered by: Combi-blocks, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(2,4-dimethoxyphenyl)-2,2,2-trifluoroethanone (CAS 578-16-5) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 1-(2,4-dimethoxyphenyl)-2,2,2-trifluoroethanone. InChIKey: SLMOFSKRLCGLIX-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 1-(2,4-dimethoxyphenyl)-2,2,2-trifluoroethanone |
| InChIKey | SLMOFSKRLCGLIX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)C(F)(F)F)OC |
Computed by PubChem (NCBI)