CAS 1214361-90-6 appears in our catalog under these names: 2-(5-Methoxy-2-(trifluoromethyl)phenyl)acetic acid, 95%, 2–(5–Methoxy–2–(trifluoromethyl)phenyl)acetic acid, 2-(5-Methoxy-2-(trifluoromethyl)phenyl)acetic acid, 2-(5-Methoxy-2-(trifluoromethyl)phenyl)acetic acid 97%, 2-(5-Methoxy-2-(trifluoromethyl)phenyl)acetic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 10g, 1g, 2,5g, 100mg.
2-[5-methoxy-2-(trifluoromethyl)phenyl]acetic acid (CAS 1214361-90-6) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 2-[5-methoxy-2-(trifluoromethyl)phenyl]acetic acid. InChIKey: PWJMIBAMJFDDMY-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 2-[5-methoxy-2-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | PWJMIBAMJFDDMY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)