CAS 468074-92-2 is the registry number for 2'-Methoxy-5'-(trifluoromethoxy)acetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanone (CAS 468074-92-2) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanone. InChIKey: DQIRVWICHOCGCY-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 1-[2-methoxy-5-(trifluoromethoxy)phenyl]ethanone |
| InChIKey | DQIRVWICHOCGCY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)OC(F)(F)F)OC |
Computed by PubChem (NCBI)