CAS 17257-71-5 appears in our catalog under these names: (S)-(-)-Alpha-methoxy-alpha-(trifluoromethyl)phenylacetic acid, 95%, (S)-(-)-Alpha-Methoxy-Alpha-(trifluoromethyl)phenylacetic Acid, >95% (HPLC), (S)–(–)–α–Methoxy–α–(trifluoromethyl)phenylacetic acid, (S)-(-)-^a-Methoxy-^a-(trifluoromethyl)phenylacetic acid, 99, (S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic Acid [Optical Resolving], >98.0%(GC)(T). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg, 50mg, 2.5g, 10g.
(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid (CAS 17257-71-5) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid. InChIKey: JJYKJUXBWFATTE-VIFPVBQESA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid |
| InChIKey | JJYKJUXBWFATTE-VIFPVBQESA-N |
| SMILES | CO[C@@](C1=CC=CC=C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)