1-(2,5-Dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione, 97%
cas: 15278-30-5 — see every product listed under this CAS number, including other names
1-(2,5-Dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione, 97% (CAS 15278-30-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 25g, 5g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11AU13-100mg |
| cas | 15278-30-5 |
| size | 100mg |
| availability | 100g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 10g | 1206.80 Pln | |
| Chemat | 25g | 2349.20 Pln | |
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1106.92 Pln | |
| Fluorochem | 10g | 2059.71 Pln | |
| Fluorochem | 25g | 3179.11 Pln | |
| Fluorochem | 100g | 8114.87 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 15278-30-5) is a chemical compound with the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. IUPAC name: 1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: YJZDMHRCYCYRKB-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O4 |
|---|---|
| Molecular weight | 276.21 g/mol |
| IUPAC name | 1-(2,5-dimethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | YJZDMHRCYCYRKB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)