Products 1445975-61-0
CAS 1445975-61-0 appears in our catalog under these names: 1-(2,6-Diisopropylphenyl)-3-methyl-1h-1,2,4-triazole, 95%, 1-(2,6-Diisopropylphenyl)-3-methyl-1H-1,2,4-triazole, ≥95%, ≥95%, 1-(2,6-DIISOPROPYLPHENYL)-3-METHYL-1H-1,2,4-TRIAZOLE, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
1-[2,6-di(propan-2-yl)phenyl]-3-methyl-1,2,4-triazole (CAS 1445975-61-0) is a chemical compound with the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. IUPAC name: 1-[2,6-di(propan-2-yl)phenyl]-3-methyl-1,2,4-triazole. InChIKey: MBPAIXIRKCMYEO-UHFFFAOYSA-N.
| Molecular formula | C15H21N3 |
|---|---|
| Molecular weight | 243.35 g/mol |
| IUPAC name | 1-[2,6-di(propan-2-yl)phenyl]-3-methyl-1,2,4-triazole |
| InChIKey | MBPAIXIRKCMYEO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=N1)C2=C(C=CC=C2C(C)C)C(C)C |
Computed by PubChem (NCBI)