CAS 1152894-77-3 is the registry number for 2,4-Dimethyl-N-((1,3,5-trimethyl-1H-pyrazol-4-yl)methyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]aniline (CAS 1152894-77-3) is a chemical compound with the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. IUPAC name: 2,4-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]aniline. InChIKey: UTRQGJFAWVMPRM-UHFFFAOYSA-N.
| Molecular formula | C15H21N3 |
|---|---|
| Molecular weight | 243.35 g/mol |
| IUPAC name | 2,4-dimethyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]aniline |
| InChIKey | UTRQGJFAWVMPRM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NCC2=C(N(N=C2C)C)C)C |
Computed by PubChem (NCBI)