Products 147084-69-3

CAS 147084-69-3 is the registry number for 1-Phenyl-3,6-diazatricyclo[4.3.1.1(3,8)]undecan-9-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine (CAS 147084-69-3) is a chemical compound with the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. IUPAC name: 1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine. InChIKey: ABIXKBMKJXACGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21N3
Molecular weight243.35 g/mol
IUPAC name1-phenyl-3,6-diazatricyclo[4.3.1.13,8]undecan-9-amine
InChIKeyABIXKBMKJXACGJ-UHFFFAOYSA-N
SMILESC1CN2CC3CN1CC(C2)(C3N)C4=CC=CC=C4

Computed by PubChem (NCBI)