CAS 2306262-89-3 is the registry number for 5-((6-Methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl)isoindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]-2,3-dihydro-1H-isoindole (CAS 2306262-89-3) is a chemical compound with the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. IUPAC name: 5-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]-2,3-dihydro-1H-isoindole. InChIKey: JVDBKZDDNNGXNT-UHFFFAOYSA-N.
| Molecular formula | C15H21N3 |
|---|---|
| Molecular weight | 243.35 g/mol |
| IUPAC name | 5-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]-2,3-dihydro-1H-isoindole |
| InChIKey | JVDBKZDDNNGXNT-UHFFFAOYSA-N |
| SMILES | CN1CC2(C1)CN(C2)CC3=CC4=C(CNC4)C=C3 |
Computed by PubChem (NCBI)