cas: 2279123-62-3 — see every product listed under this CAS number, including other names
1-(2-Chlorophenyl)cyclopentane-1-carboxamide 95% (CAS 2279123-62-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2728111-50mg |
| cas | 2279123-62-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 648.50 Pln | |
| Ambeed | 100mg | 1043.44 Pln | |
| Ambeed | 250mg | 1816.62 Pln | |
| Ambeed | 1g | 4781.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2728111 |
1-(2-chlorophenyl)cyclopentane-1-carboxamide (CAS 2279123-62-3) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 1-(2-chlorophenyl)cyclopentane-1-carboxamide. InChIKey: LQTWSHXEBXHPOE-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 1-(2-chlorophenyl)cyclopentane-1-carboxamide |
| InChIKey | LQTWSHXEBXHPOE-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2Cl)C(=O)N |
Computed by PubChem (NCBI)