Products 2279123-62-3
CAS 2279123-62-3 appears in our catalog under these names: 1-(2-Chlorophenyl)cyclopentanecarboxamide, 95%, 1-(2-Chlorophenyl)cyclopentane-1-carboxamide 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg.
1-(2-chlorophenyl)cyclopentane-1-carboxamide (CAS 2279123-62-3) is a chemical compound with the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. IUPAC name: 1-(2-chlorophenyl)cyclopentane-1-carboxamide. InChIKey: LQTWSHXEBXHPOE-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO |
|---|---|
| Molecular weight | 223.70 g/mol |
| IUPAC name | 1-(2-chlorophenyl)cyclopentane-1-carboxamide |
| InChIKey | LQTWSHXEBXHPOE-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2Cl)C(=O)N |
Computed by PubChem (NCBI)