cas: 1402166-71-5 — see every product listed under this CAS number, including other names
1-(2-Cyanophenyl)pyrazole-4-boronic acid, pinacol ester, 98%, 98% (CAS 1402166-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110WUE-100mg |
| cas | 1402166-71-5 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 1g | 904.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile (CAS 1402166-71-5) is a chemical compound with the molecular formula C16H18BN3O2 and a molecular weight of 295.1 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile. InChIKey: JSAWKFWFDZKIQF-UHFFFAOYSA-N.
| Molecular formula | C16H18BN3O2 |
|---|---|
| Molecular weight | 295.1 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile |
| InChIKey | JSAWKFWFDZKIQF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3=CC=CC=C3C#N |
Computed by PubChem (NCBI)