CAS 546142-08-9 is the registry number for 3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazol-1-yl)benzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile (CAS 546142-08-9) is a chemical compound with the molecular formula C16H18BN3O2 and a molecular weight of 295.1 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile. InChIKey: APMKAYJGHHCBBR-UHFFFAOYSA-N.
| Molecular formula | C16H18BN3O2 |
|---|---|
| Molecular weight | 295.1 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile |
| InChIKey | APMKAYJGHHCBBR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3=CC=CC(=C3)C#N |
Computed by PubChem (NCBI)