CAS 2223055-73-8 is the registry number for 4-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazol-1-yl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile (CAS 2223055-73-8) is a chemical compound with the molecular formula C16H18BN3O2 and a molecular weight of 295.1 g/mol. IUPAC name: 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile. InChIKey: QGXWODBDYVRGPJ-UHFFFAOYSA-N.
| Molecular formula | C16H18BN3O2 |
|---|---|
| Molecular weight | 295.1 g/mol |
| IUPAC name | 4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile |
| InChIKey | QGXWODBDYVRGPJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)