CAS 1402166-71-5 appears in our catalog under these names: 1-(2-Cyanophenyl)pyrazole-4-boronic acid, pinacol ester, 98%, 1-(2-Cyanophenyl)pyrazole-4-boronic acid, pinacol ester, 95-<97%, 1-(2-Cyanophenyl)pyrazole-4-boronic acid, pinacol ester, ≥97-<99%, 2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)benzonitrile 98%, 1-(2-Cyanophenyl)pyrazole-4-boronic acid, pinacol ester, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 50g, 100g, 100mg, 250mg.
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile (CAS 1402166-71-5) is a chemical compound with the molecular formula C16H18BN3O2 and a molecular weight of 295.1 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile. InChIKey: JSAWKFWFDZKIQF-UHFFFAOYSA-N.
| Molecular formula | C16H18BN3O2 |
|---|---|
| Molecular weight | 295.1 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]benzonitrile |
| InChIKey | JSAWKFWFDZKIQF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3=CC=CC=C3C#N |
Computed by PubChem (NCBI)